Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Category: amides-buliding-blocks, 45120-30-7, Name is H-Glu-OtBu, SMILES is O=C(O)CC[C@H](N)C(OC(C)(C)C)=O, belongs to amides-buliding-blocks compound. In a document, author is Sheikh, Mahdi, introduce the new discover.
Total synthesis of the anticancer peptide natural product yaku’amide A is reported. Its beta-tert-hydroxy amino acids were prepared by regioselective aminohydroxylation involving a chiral mesyloxycarbamate reagent. Stereospecific construction of the E- and Z-Delta Ile residues was accomplished through a one-pot reaction featuring anti dehydration, azide reduction, and O -> N acyl transfer. Alkene isomerization was negligible during this process. These methods enabled a highly convergent and efficient synthetic route to the natural product.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 45120-30-7. Category: amides-buliding-blocks.
Reference:
Amide – Wikipedia,
,Amide – an overview | ScienceDirect Topics